EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:755045 - lurtotecan dihydrochloride
| Formula | HCl.C28H30N4O6.HCl |
| Net Charge | 0 |
| Average Mass | 591.492 |
| Monoisotopic Mass | 590.16989 |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc3c(cc1c2CN1CCN(C)CC1)OCCO3.Cl.Cl |
| InChI | InChI=1S/C28H30N4O6.2ClH/c1-3-28(35)20-11-22-25-18(14-32(22)26(33)19(20)15-38-27(28)34)17(13-31-6-4-30(2)5-7-31)16-10-23-24(12-21(16)29-25)37-9-8-36-23;;/h10-12,35H,3-9,13-15H2,1-2H3;2*1H/t28-;;/m0../s1 |
| InChIKey | ORIWMYRMOGIXGG-ZXVJYWQYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lurtotecan dihydrochloride (CHEBI:755045) is a pyranoindolizinoquinoline (CHEBI:48626) |
| Synonyms | Source |
|---|---|
| GI-147211C | ChEMBL |
| GI147211C | ChEMBL |
| Lurtotecan dihydrochloride | ChEMBL |