EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H27NO2 |
| Net Charge | 0 |
| Average Mass | 289.419 |
| Monoisotopic Mass | 289.20418 |
| SMILES | COc1ccc(NC(=O)[C@@H]2C[C@H](C)CC[C@H]2C(C)C)cc1 |
| InChI | InChI=1S/C18H27NO2/c1-12(2)16-10-5-13(3)11-17(16)18(20)19-14-6-8-15(21-4)9-7-14/h6-9,12-13,16-17H,5,10-11H2,1-4H3,(H,19,20)/t13-,16+,17-/m1/s1 |
| InChIKey | HNSGVPAAXJJOPQ-XOKHGSTOSA-N |
| Roles Classification |
|---|
| Application: | ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acoltremon (CHEBI:755043) has role ophthalmology drug (CHEBI:66981) |
| acoltremon (CHEBI:755043) is a monoterpenoid (CHEBI:25409) |
| INN | Source |
|---|---|
| acoltremon | WHO MedNet |
| Synonyms | Source |
|---|---|
| AR-15512 | ChEMBL |
| AVX-012 | ChEMBL |
| FEMA NO. 4681 | ChEMBL |
| WS-12 | ChEMBL |
| Citations |
|---|