EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30N6O2 |
| Net Charge | 0 |
| Average Mass | 410.522 |
| Monoisotopic Mass | 410.24302 |
| SMILES | CCCCOc1nc(N)c2c(n1)N(Cc1cccc(CN3CCCC3)c1)CC(=O)N2 |
| InChI | InChI=1S/C22H30N6O2/c1-2-3-11-30-22-25-20(23)19-21(26-22)28(15-18(29)24-19)14-17-8-6-7-16(12-17)13-27-9-4-5-10-27/h6-8,12H,2-5,9-11,13-15H2,1H3,(H,24,29)(H2,23,25,26) |
| InChIKey | VFOKSTCIRGDTBR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antiviral agent A substance that destroys or inhibits replication of viruses. anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vesatolimod (CHEBI:755039) has role anti-HBV agent (CHEBI:64951) |
| vesatolimod (CHEBI:755039) has role anti-HIV agent (CHEBI:64946) |
| vesatolimod (CHEBI:755039) has role antiviral agent (CHEBI:22587) |
| vesatolimod (CHEBI:755039) is a α-amino acid (CHEBI:33704) |
| INN | Source |
|---|---|
| vesatolimod | WHO MedNet |
| Synonym | Source |
|---|---|
| GS-9620 | ChEMBL |
| Citations |
|---|