EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:755038 - deleobuvir
| Formula | C34H33BrN6O3 |
| Net Charge | 0 |
| Average Mass | 653.581 |
| Monoisotopic Mass | 652.17975 |
| SMILES | Cn1c(C2(NC(=O)c3ccc4c(C5CCCC5)c(-c5ncc(Br)cn5)n(C)c4c3)CCC2)nc2ccc(/C=C/C(=O)O)cc21 |
| InChI | InChI=1S/C34H33BrN6O3/c1-40-26-17-22(10-11-24(26)29(21-6-3-4-7-21)30(40)31-36-18-23(35)19-37-31)32(44)39-34(14-5-15-34)33-38-25-12-8-20(9-13-28(42)43)16-27(25)41(33)2/h8-13,16-19,21H,3-7,14-15H2,1-2H3,(H,39,44)(H,42,43)/b13-9+ |
| InChIKey | BMAIGAHXAJEULY-UKTHLTGXSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deleobuvir (CHEBI:755038) has role antiviral agent (CHEBI:22587) |
| deleobuvir (CHEBI:755038) is a indolecarboxamide (CHEBI:46921) |
| INN | Source |
|---|---|
| deleobuvir | WHO MedNet |
| Synonyms | Source |
|---|---|
| BI 207127 | ChEMBL |
| BI-207127 | ChEMBL |
| Citations |
|---|