EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H37N5O3 |
| Net Charge | 0 |
| Average Mass | 455.603 |
| Monoisotopic Mass | 455.28964 |
| SMILES | COC(=O)N1CCC(CN2CCC(CNC(=O)c3cccc4nc(C(C)C)nc34)CC2)CC1 |
| InChI | InChI=1S/C25H37N5O3/c1-17(2)23-27-21-6-4-5-20(22(21)28-23)24(31)26-15-18-7-11-29(12-8-18)16-19-9-13-30(14-10-19)25(32)33-3/h4-6,17-19H,7-16H2,1-3H3,(H,26,31)(H,27,28) |
| InChIKey | MZOITCJKGUIQEI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| felcisetrag (CHEBI:755037) has role gastrointestinal drug (CHEBI:55324) |
| felcisetrag (CHEBI:755037) has role renoprotective agent (CHEBI:231911) |
| felcisetrag (CHEBI:755037) is a benzimidazoles (CHEBI:22715) |
| INN | Source |
|---|---|
| felcisetrag | WHO MedNet |
| Synonyms | Source |
|---|---|
| TAK-954 | ChEMBL |
| TD-8954 | ChEMBL |
| THRX-149699 | ChEMBL |
| Citations |
|---|