EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H34F3N7O3 |
| Net Charge | 0 |
| Average Mass | 561.609 |
| Monoisotopic Mass | 561.26752 |
| SMILES | COc1cc(C(=O)NC2CCN(C)CC2)c(F)cc1Nc1ncc2c(n1)N(C1CCCC1)CC(F)(F)C(=O)N2C |
| InChI | InChI=1S/C27H34F3N7O3/c1-35-10-8-16(9-11-35)32-24(38)18-12-22(40-3)20(13-19(18)28)33-26-31-14-21-23(34-26)37(17-6-4-5-7-17)15-27(29,30)25(39)36(21)2/h12-14,16-17H,4-11,15H2,1-3H3,(H,32,38)(H,31,33,34) |
| InChIKey | GWRSATNRNFYMDI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tak-960 (CHEBI:755033) has role antineoplastic agent (CHEBI:35610) |
| tak-960 (CHEBI:755033) is a pyrimidodiazepine (CHEBI:39306) |
| Synonyms | Source |
|---|---|
| TAK-960 | ChEMBL |
| TAK960 | ChEMBL |
| Citations |
|---|