EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18BrN7 |
| Net Charge | 0 |
| Average Mass | 376.262 |
| Monoisotopic Mass | 375.08071 |
| SMILES | Cn1cc(-c2cnn3c(N)c(Br)c([C@@H]4CCCNC4)nc23)cn1 |
| InChI | InChI=1S/C15H18BrN7/c1-22-8-10(6-19-22)11-7-20-23-14(17)12(16)13(21-15(11)23)9-3-2-4-18-5-9/h6-9,18H,2-5,17H2,1H3/t9-/m1/s1 |
| InChIKey | GMIZZEXBPRLVIV-SECBINFHSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sch-900776 (CHEBI:755029) has role antineoplastic agent (CHEBI:35610) |
| sch-900776 (CHEBI:755029) is a pyrazolopyrimidine (CHEBI:38669) |
| Synonyms | Source |
|---|---|
| Mk-8776 | ChEMBL |
| Sch-900776 | ChEMBL |
| SCH 900776 | ChEMBL |
| Citations |
|---|