EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H48Cl2N4O4S |
| Net Charge | 0 |
| Average Mass | 727.799 |
| Monoisotopic Mass | 726.27733 |
| SMILES | CCOc1cc(C(C)(C)C)ccc1C1=N[C@@](C)(c2ccc(Cl)cc2)[C@@](C)(c2ccc(Cl)cc2)N1C(=O)N1CCN(CCCS(C)(=O)=O)CC1 |
| InChI | InChI=1S/C38H48Cl2N4O4S/c1-8-48-33-26-29(36(2,3)4)14-19-32(33)34-41-37(5,27-10-15-30(39)16-11-27)38(6,28-12-17-31(40)18-13-28)44(34)35(45)43-23-21-42(22-24-43)20-9-25-49(7,46)47/h10-19,26H,8-9,20-25H2,1-7H3/t37-,38+/m0/s1 |
| InChIKey | QBGKPEROWUKSBK-QPPIDDCLSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ro-5045337 (CHEBI:755026) has role antineoplastic agent (CHEBI:35610) |
| ro-5045337 (CHEBI:755026) is a stilbenoid (CHEBI:26776) |
| Synonyms | Source |
|---|---|
| Mdm2 antagonist ro5045337 | ChEMBL |
| R 7112 | ChEMBL |
| RG-7112 | ChEMBL |
| RG7112 | ChEMBL |
| RO-5045337 | ChEMBL |
| RO5045337 | ChEMBL |
| Citations |
|---|