EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.C19H20N2O3.CH4O3S |
| Net Charge | 0 |
| Average Mass | 438.502 |
| Monoisotopic Mass | 438.14607 |
| SMILES | CS(=O)(=O)O.O.[H][C@@]12C[C@]3([H])C[C@H](OC(=O)c4cnc5ccccc45)C[C@]([H])(C1)N3CC2=O |
| InChI | InChI=1S/C19H20N2O3.CH4O3S.H2O/c22-18-10-21-12-5-11(18)6-13(21)8-14(7-12)24-19(23)16-9-20-17-4-2-1-3-15(16)17;1-5(2,3)4;/h1-4,9,11-14,20H,5-8,10H2;1H3,(H,2,3,4);1H2/t11-,12-,13+,14+;; |
| InChIKey | QTFFGPOXNNGTGZ-LIFGOUTFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dolasetron mesylate (CHEBI:755015) has role antineoplastic agent (CHEBI:35610) |
| dolasetron mesylate (CHEBI:755015) is a indolyl carboxylic acid (CHEBI:46867) |
| Synonyms | Source |
|---|---|
| Dolasetron mesilate monohydrate | ChEMBL |
| Dolasetron mesylate anhydrous | ChEMBL |
| Dolasetron mesylate monohydrate | ChEMBL |
| MDL-73147EF | ChEMBL |