EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H24F3N3O2 |
| Net Charge | 0 |
| Average Mass | 455.480 |
| Monoisotopic Mass | 455.18206 |
| SMILES | O=C(O)C[C@H]1CC[C@H](c2ccc(-c3ccc(Nc4ccc(C(F)(F)F)nc4)cn3)cc2)CC1 |
| InChI | InChI=1S/C25H24F3N3O2/c26-25(27,28)23-12-10-21(15-30-23)31-20-9-11-22(29-14-20)19-7-5-18(6-8-19)17-3-1-16(2-4-17)13-24(32)33/h5-12,14-17,31H,1-4,13H2,(H,32,33)/t16-,17- |
| InChIKey | GXALXAKNHIROPE-QAQDUYKDSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Applications: | laxative An agent that produces a soft formed stool, and relaxes and loosens the bowels, typically used over a protracted period, to relieve constipation. Compare with cathartic, which is a substance that accelerates defecation. A substances can be both a laxative and a cathartic. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pradigastat (CHEBI:754985) has role antiviral agent (CHEBI:22587) |
| pradigastat (CHEBI:754985) has role laxative (CHEBI:50503) |
| pradigastat (CHEBI:754985) has role renoprotective agent (CHEBI:231911) |
| pradigastat (CHEBI:754985) is a chloropyridine (CHEBI:39173) |
| INN | Source |
|---|---|
| pradigastat | WHO MedNet |
| Synonyms | Source |
|---|---|
| Lcq-908 | ChEMBL |
| Lcq908 - dgat-1-inhibitor | ChEMBL |
| LCQ-908-NXA | ChEMBL |
| LCQ-908NXA | ChEMBL |
| LCQ908-NXA | ChEMBL |
| Citations |
|---|