EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:754984 - plazomicin sulfate
| Formula | H2O4S.C25H48N6O10 |
| Net Charge | 0 |
| Average Mass | 690.770 |
| Monoisotopic Mass | 690.31057 |
| SMILES | O=S(=O)(O)O.[H][C@](O)(CCN)C(=O)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2OC(CNCCO)=CC[C@H]2N)[C@H](O)[C@H]1O[C@H]1OC[C@](C)(O)[C@H](NC)[C@H]1O |
| InChI | InChI=1S/C25H48N6O10.H2O4S/c1-25(37)11-38-24(18(35)21(25)29-2)41-20-15(31-22(36)16(33)5-6-26)9-14(28)19(17(20)34)40-23-13(27)4-3-12(39-23)10-30-7-8-32;1-5(2,3)4/h3,13-21,23-24,29-30,32-35,37H,4-11,26-28H2,1-2H3,(H,31,36);(H2,1,2,3,4)/t13-,14+,15-,16+,17+,18-,19-,20+,21-,23-,24-,25+;/m1./s1 |
| InChIKey | SFTBRKHJMASSAP-BGJNVEJLSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| plazomicin sulfate (CHEBI:754984) has functional parent γ-amino acid (CHEBI:33707) |
| plazomicin sulfate (CHEBI:754984) has role antibacterial agent (CHEBI:33282) |
| plazomicin sulfate (CHEBI:754984) has role antiinfective agent (CHEBI:35441) |
| plazomicin sulfate (CHEBI:754984) is a organonitrogen compound (CHEBI:35352) |
| plazomicin sulfate (CHEBI:754984) is a organooxygen compound (CHEBI:36963) |
| Synonyms | Source |
|---|---|
| ACHN-490 SULFATE | ChEMBL |
| Plazomicin hemipentasulfate | ChEMBL |
| Plazomicin sulfate | ChEMBL |
| Brand Name | Source |
|---|---|
| Zemdri | ChEMBL |