EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:754975 - doravirine
| Formula | C17H11ClF3N5O3 |
| Net Charge | 0 |
| Average Mass | 425.754 |
| Monoisotopic Mass | 425.05025 |
| SMILES | Cn1c(Cn2ccc(C(F)(F)F)c(Oc3cc(Cl)cc(C#N)c3)c2=O)nnc1=O |
| InChI | InChI=1S/C17H11ClF3N5O3/c1-25-13(23-24-16(25)28)8-26-3-2-12(17(19,20)21)14(15(26)27)29-11-5-9(7-22)4-10(18)6-11/h2-6H,8H2,1H3,(H,24,28) |
| InChIKey | ZIAOVIPSKUPPQW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| Application: | renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| doravirine (CHEBI:754975) has role anti-HIV agent (CHEBI:64946) |
| doravirine (CHEBI:754975) has role antiviral agent (CHEBI:22587) |
| doravirine (CHEBI:754975) has role renoprotective agent (CHEBI:231911) |
| doravirine (CHEBI:754975) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| doravirina | WHO MedNet |
| Synonyms | Source |
|---|---|
| Doravirine | ChEMBL |
| MK-1439 | ChEMBL |
| Mk-1439a | ChEMBL |
| Brand Names | Source |
|---|---|
| Doravirine component of delstrigo | ChEMBL |
| Pifeltro | ChEMBL |
| Citations |
|---|