EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C21H23F2N3O4 |
| Net Charge | 0 |
| Average Mass | 455.889 |
| Monoisotopic Mass | 455.14234 |
| SMILES | COc1c(N2CCC/C(=C(\F)CN)C2)c(F)cc2c(=O)c(C(=O)O)cn(C3CC3)c12.Cl |
| InChI | InChI=1S/C21H23F2N3O4.ClH/c1-30-20-17-13(19(27)14(21(28)29)10-26(17)12-4-5-12)7-15(22)18(20)25-6-2-3-11(9-25)16(23)8-24;/h7,10,12H,2-6,8-9,24H2,1H3,(H,28,29);1H/b16-11+; |
| InChIKey | RDXCNSOGHLLWDV-YFMOEUEHSA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acorafloxacin hydrochloride (CHEBI:754973) has role antibacterial agent (CHEBI:33282) |
| acorafloxacin hydrochloride (CHEBI:754973) has role antiinfective agent (CHEBI:35441) |
| acorafloxacin hydrochloride (CHEBI:754973) is a quinolines (CHEBI:26513) |
| Synonyms | Source |
|---|---|
| Acorafloxacin hydrochloride | ChEMBL |
| Jnj-32729463 | ChEMBL |
| JNJ-32729463-AAC | ChEMBL |
| JNJ-32729463AAC | ChEMBL |
| Jnj-q2 hydrochloride | ChEMBL |