EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O10 |
| Net Charge | 0 |
| Average Mass | 398.364 |
| Monoisotopic Mass | 398.12130 |
| SMILES | COc1cc(/C=C/C(=O)O[C@H]2[C@H](O)C[C@](O)(C(=O)O)C[C@H]2O)cc(OC)c1O |
| InChI | InChI=1S/C18H22O10/c1-26-12-5-9(6-13(27-2)15(12)22)3-4-14(21)28-16-10(19)7-18(25,17(23)24)8-11(16)20/h3-6,10-11,16,19-20,22,25H,7-8H2,1-2H3,(H,23,24)/b4-3+/t10-,11-,16-,18+/m1/s1 |
| InChIKey | WKRKXTOYTASIOP-RKTLJHTASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllanthus niruri (ncbitaxon:296034) | - | MetaboLights (MTBLS224) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-O-sinapoylquinic acid (CHEBI:75496) has functional parent (−)-quinic acid (CHEBI:17521) |
| 4-O-sinapoylquinic acid (CHEBI:75496) has functional parent trans-sinapic acid (CHEBI:15714) |
| 4-O-sinapoylquinic acid (CHEBI:75496) is a cinnamate ester (CHEBI:36087) |
| 4-O-sinapoylquinic acid (CHEBI:75496) is a quinic acid (CHEBI:26493) |
| IUPAC Name |
|---|
| (1S,3R,4S,5R)-1,3,5-trihydroxy-4-{[(2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxy}cyclohexanecarboxylic acid |
| Synonym | Source |
|---|---|
| 4-sinapoylquinic acid | ChEBI |