EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25N5OS2 |
| Net Charge | 0 |
| Average Mass | 403.577 |
| Monoisotopic Mass | 403.15005 |
| SMILES | CC(C)C[C@H](CO)Nc1nc(S[C@@H](C)c2ccccc2)nc2nc(N)sc12 |
| InChI | InChI=1S/C19H25N5OS2/c1-11(2)9-14(10-25)21-16-15-17(22-18(20)27-15)24-19(23-16)26-12(3)13-7-5-4-6-8-13/h4-8,11-12,14,25H,9-10H2,1-3H3,(H3,20,21,22,23,24)/t12-,14+/m0/s1 |
| InChIKey | ZMQSLMZOWVGBSM-GXTWGEPZSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd-8797 (CHEBI:754958) has role antiviral agent (CHEBI:22587) |
| azd-8797 (CHEBI:754958) is a aryl sulfide (CHEBI:35683) |
| Synonyms | Source |
|---|---|
| Azd-8797 | ChEMBL |
| AZD8797 | ChEMBL |
| Kand-567 | ChEMBL |
| Kand567 | ChEMBL |
| Citations |
|---|