EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:754957 - filanesib
| Formula | C20H22F2N4O2S |
| Net Charge | 0 |
| Average Mass | 420.485 |
| Monoisotopic Mass | 420.14315 |
| SMILES | CON(C)C(=O)N1N=C(c2cc(F)ccc2F)S[C@@]1(CCCN)c1ccccc1 |
| InChI | InChI=1S/C20H22F2N4O2S/c1-25(28-2)19(27)26-20(11-6-12-23,14-7-4-3-5-8-14)29-18(24-26)16-13-15(21)9-10-17(16)22/h3-5,7-10,13H,6,11-12,23H2,1-2H3/t20-/m0/s1 |
| InChIKey | LLXISKGBWFTGEI-FQEVSTJZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| filanesib (CHEBI:754957) has role antineoplastic agent (CHEBI:35610) |
| filanesib (CHEBI:754957) is a benzenes (CHEBI:22712) |
| filanesib (CHEBI:754957) is a organic amino compound (CHEBI:50047) |
| INN | Source |
|---|---|
| filanesib | WHO MedNet |
| Synonym | Source |
|---|---|
| ARRY-520 | ChEMBL |
| Citations |
|---|