EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32F3N7O2 |
| Net Charge | 0 |
| Average Mass | 519.572 |
| Monoisotopic Mass | 519.25696 |
| SMILES | CC(=O)N1CCN(CCOc2ccc(C3CCN(C4=Nn5c(nnc5C(F)(F)F)CC4)CC3)cc2)CC1 |
| InChI | InChI=1S/C25H32F3N7O2/c1-18(36)33-14-12-32(13-15-33)16-17-37-21-4-2-19(3-5-21)20-8-10-34(11-9-20)23-7-6-22-29-30-24(25(26,27)28)35(22)31-23/h2-5,20H,6-17H2,1H3 |
| InChIKey | JMEYDSHPKCSIJC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd3514 (CHEBI:754955) has role antineoplastic agent (CHEBI:35610) |
| azd3514 (CHEBI:754955) is a piperidines (CHEBI:26151) |
| Synonyms | Source |
|---|---|
| Azd 3514 | ChEMBL |
| Azd3514 | ChEMBL |
| AZD-3514 | ChEMBL |
| CS-1443 | ChEMBL |
| Citations |
|---|