EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12FN3 |
| Net Charge | 0 |
| Average Mass | 265.291 |
| Monoisotopic Mass | 265.10153 |
| SMILES | Fc1ccc2nc(CCC#Cc3ccccn3)cn2c1 |
| InChI | InChI=1S/C16H12FN3/c17-13-8-9-16-19-15(12-20(16)11-13)7-2-1-5-14-6-3-4-10-18-14/h3-4,6,8-12H,2,7H2 |
| InChIKey | LZXMUJCJAWVHPZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dipraglurant (CHEBI:754954) has role antiparkinson drug (CHEBI:48407) |
| dipraglurant (CHEBI:754954) has role antispasmodic drug (CHEBI:53784) |
| dipraglurant (CHEBI:754954) is a imidazopyridine (CHEBI:46908) |
| INN | Source |
|---|---|
| dipraglurant | WHO MedNet |
| Synonyms | Source |
|---|---|
| ADX-48621 | ChEMBL |
| ADX48621 | ChEMBL |
| Citations |
|---|