EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:754953 - luvadaxistat
| Formula | C13H11F3N2O2 |
| Net Charge | 0 |
| Average Mass | 284.237 |
| Monoisotopic Mass | 284.07726 |
| SMILES | O=c1nnc(CCc2ccc(C(F)(F)F)cc2)cc1O |
| InChI | InChI=1S/C13H11F3N2O2/c14-13(15,16)9-4-1-8(2-5-9)3-6-10-7-11(19)12(20)18-17-10/h1-2,4-5,7H,3,6H2,(H,17,19)(H,18,20) |
| InChIKey | QBQMUMMSYHUDFM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| luvadaxistat (CHEBI:754953) has role antipsychotic agent (CHEBI:35476) |
| luvadaxistat (CHEBI:754953) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| INN | Source |
|---|---|
| luvadaxistat | WHO MedNet |
| Synonyms | Source |
|---|---|
| TAK-831 | ChEMBL |
| TAK831 | ChEMBL |
| Citations |
|---|