EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30N6O3 |
| Net Charge | 0 |
| Average Mass | 462.554 |
| Monoisotopic Mass | 462.23794 |
| SMILES | CNC(=O)c1cccc(-c2ccc3c(N4CCOC[C@@H]4C)nc(N4CCOC[C@@H]4C)nc3n2)c1 |
| InChI | InChI=1S/C25H30N6O3/c1-16-14-33-11-9-30(16)23-20-7-8-21(18-5-4-6-19(13-18)24(32)26-3)27-22(20)28-25(29-23)31-10-12-34-15-17(31)2/h4-8,13,16-17H,9-12,14-15H2,1-3H3,(H,26,32)/t16-,17-/m0/s1 |
| InChIKey | JUSFANSTBFGBAF-IRXDYDNUSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vistusertib (CHEBI:754952) has role antineoplastic agent (CHEBI:35610) |
| vistusertib (CHEBI:754952) is a pyridopyrimidine (CHEBI:38932) |
| INN | Source |
|---|---|
| vistusertib | WHO MedNet |
| Synonyms | Source |
|---|---|
| AZD-2014 | ChEMBL |
| AZD2014 | ChEMBL |
| Citations |
|---|