EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6O6.C14H23N3OS |
| Net Charge | 0 |
| Average Mass | 431.511 |
| Monoisotopic Mass | 431.17262 |
| SMILES | CCCCCCOc1nsnc1C1=CCCN(C)C1.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C14H23N3OS.C4H6O6/c1-3-4-5-6-10-18-14-13(15-19-16-14)12-8-7-9-17(2)11-12;5-1(3(7)8)2(6)4(9)10/h8H,3-7,9-11H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | SJSVWTMVMBGIHQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| xanomeline tartrate (CHEBI:754950) has role antipsychotic agent (CHEBI:35476) |
| xanomeline tartrate (CHEBI:754950) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| LY-246708 TARTRATE | ChEMBL |
| LY246708 TARTRATE | ChEMBL |
| Xanomeline (+)-l-hydrogen tartrate | ChEMBL |
| Xanomeline tartaric acid | ChEMBL |
| Brand Name | Source |
|---|---|
| Xanomeline tartrate component of cobenfy | ChEMBL |
| Citations |
|---|