EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32N6O3 |
| Net Charge | 0 |
| Average Mass | 452.559 |
| Monoisotopic Mass | 452.25359 |
| SMILES | CCNC(=O)Nc1ccc(-c2nc3c(c(N4CCOC[C@@H]4C)n2)CCN(C2COC2)C3)cc1 |
| InChI | InChI=1S/C24H32N6O3/c1-3-25-24(31)26-18-6-4-17(5-7-18)22-27-21-12-29(19-14-33-15-19)9-8-20(21)23(28-22)30-10-11-32-13-16(30)2/h4-7,16,19H,3,8-15H2,1-2H3,(H2,25,26,31)/t16-/m0/s1 |
| InChIKey | RGJOJUGRHPQXGF-INIZCTEOSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rg-7603 (CHEBI:754948) has role antineoplastic agent (CHEBI:35610) |
| rg-7603 (CHEBI:754948) is a ureas (CHEBI:47857) |
| Synonyms | Source |
|---|---|
| GDC-0349 | ChEMBL |
| Rg-7603 | ChEMBL |
| Citations |
|---|