EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H21N5O3S |
| Net Charge | 0 |
| Average Mass | 471.542 |
| Monoisotopic Mass | 471.13651 |
| SMILES | Cn1cc(-c2cnc3ccc4ccc(CS(=O)(=O)NCc5ccccn5)cc4c(=O)c3c2)cn1 |
| InChI | InChI=1S/C25H21N5O3S/c1-30-15-20(13-28-30)19-11-23-24(27-12-19)8-7-18-6-5-17(10-22(18)25(23)31)16-34(32,33)29-14-21-4-2-3-9-26-21/h2-13,15,29H,14,16H2,1H3 |
| InChIKey | VMJFTOSOFDEKTM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mk-8033 (CHEBI:754943) has role antineoplastic agent (CHEBI:35610) |
| mk-8033 (CHEBI:754943) is a pyrazolopyridine (CHEBI:46699) |
| Synonyms | Source |
|---|---|
| Mk-8033 | ChEMBL |
| MK8033 | ChEMBL |
| Citations |
|---|