EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Mg.C8H15O2.C8H15O2 |
| Net Charge | 0 |
| Average Mass | 310.717 |
| Monoisotopic Mass | 310.19945 |
| SMILES | CCCC(CCC)C(=O)[O-].CCCC(CCC)C(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C8H16O2.Mg/c2*1-3-5-7(6-4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | LKLLHOIUJVEAGU-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| magnesium valproate (CHEBI:754941) has role antineoplastic agent (CHEBI:35610) |
| magnesium valproate (CHEBI:754941) is a dicarboxylic acid (CHEBI:35692) |
| Synonym | Source |
|---|---|
| Valproate magnesium | ChEMBL |
| Brand Name | Source |
|---|---|
| Dipromal | ChEMBL |
| Citations |
|---|