EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21NO5 |
| Net Charge | 0 |
| Average Mass | 367.401 |
| Monoisotopic Mass | 367.14197 |
| SMILES | CN1CCC(c2c(O)cc(O)c3c(=O)cc(-c4ccccc4)oc23)C1CO |
| InChI | InChI=1S/C21H21NO5/c1-22-8-7-13(14(22)11-23)19-15(24)9-16(25)20-17(26)10-18(27-21(19)20)12-5-3-2-4-6-12/h2-6,9-10,13-14,23-25H,7-8,11H2,1H3 |
| InChIKey | HRTOUPQLDWWXIX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| p-276-00 (CHEBI:754940) has role antineoplastic agent (CHEBI:35610) |
| p-276-00 (CHEBI:754940) is a hydroxyflavonoid (CHEBI:71968) |
| Synonyms | Source |
|---|---|
| P 276-00 | ChEMBL |
| P-276-00 | ChEMBL |
| P-27600 | ChEMBL |