EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:754935 - cefcanel daloxate
| Formula | C27H27N5O9S3 |
| Net Charge | 0 |
| Average Mass | 661.740 |
| Monoisotopic Mass | 661.09709 |
| SMILES | [H][C@]12SCC(CSc3nnc(C)s3)=C(C(=O)OCc3oc(=O)oc3C)N1C(=O)[C@H]2NC(=O)[C@H](OC(=O)[C@@H](C)N)c1ccccc1 |
| InChI | InChI=1S/C27H27N5O9S3/c1-12(28)24(35)41-20(15-7-5-4-6-8-15)21(33)29-18-22(34)32-19(25(36)38-9-17-13(2)39-27(37)40-17)16(10-42-23(18)32)11-43-26-31-30-14(3)44-26/h4-8,12,18,20,23H,9-11,28H2,1-3H3,(H,29,33)/t12-,18-,20-,23-/m1/s1 |
| InChIKey | AMMYEZPDRKXESR-CEJYENBDSA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefcanel daloxate (CHEBI:754935) is a cephalosporin (CHEBI:23066) |
| INNs | Source |
|---|---|
| cefcanel daloxate | WHO MedNet |
| cefcanel daloxato | WHO MedNet |