EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H17N5O9S2 |
| Net Charge | 0 |
| Average Mass | 535.516 |
| Monoisotopic Mass | 535.04677 |
| SMILES | [H][C@]12SCC=C(C(=O)O)N1C(=O)[C@H]2NC(=O)/C(=N/O[C@H](C(=O)O)c1ccc(O)c(O)c1)c1csc(N)n1 |
| InChI | InChI=1S/C20H17N5O9S2/c21-20-22-8(6-36-20)12(24-34-14(19(32)33)7-1-2-10(26)11(27)5-7)15(28)23-13-16(29)25-9(18(30)31)3-4-35-17(13)25/h1-3,5-6,13-14,17,26-27H,4H2,(H2,21,22)(H,23,28)(H,30,31)(H,32,33)/b24-12+/t13-,14+,17-/m1/s1 |
| InChIKey | ILZCDOYRDFDUPN-UITOYEBDSA-N |
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cefetecol (CHEBI:754934) is a cephalosporin (CHEBI:23066) |
| Synonyms | Source |
|---|---|
| Cefetecol | ChEMBL |
| Cefetecol anhydrous | ChEMBL |
| GR 69153X | ChEMBL |
| GR-69153X | ChEMBL |