EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H14F2N2O3 |
| Net Charge | 0 |
| Average Mass | 356.328 |
| Monoisotopic Mass | 356.09725 |
| SMILES | COc1cccc(-c2cc(F)c(Nc3ncccc3C(=O)O)c(F)c2)c1 |
| InChI | InChI=1S/C19H14F2N2O3/c1-26-13-5-2-4-11(8-13)12-9-15(20)17(16(21)10-12)23-18-14(19(24)25)6-3-7-22-18/h2-10H,1H3,(H,22,23)(H,24,25) |
| InChIKey | OMPATGZMNFWVOH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aslan-003 (CHEBI:754932) has role antineoplastic agent (CHEBI:35610) |
| aslan-003 (CHEBI:754932) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| INN | Source |
|---|---|
| farudodstat | WHO MedNet |
| Synonyms | Source |
|---|---|
| ASLAN-003 | ChEMBL |
| ASLAN003 | ChEMBL |
| Citations |
|---|