EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H27NO3 |
| Net Charge | 0 |
| Average Mass | 293.407 |
| Monoisotopic Mass | 293.19909 |
| SMILES | [H][C@]12OC(=O)[C@@H](CN(C)C)[C@]1([H])CCC(C)=C1CC[C@@](C)(O)[C@@]12[H] |
| InChI | InChI=1S/C17H27NO3/c1-10-5-6-12-13(9-18(3)4)16(19)21-15(12)14-11(10)7-8-17(14,2)20/h12-15,20H,5-9H2,1-4H3/t12-,13-,14-,15-,17+/m0/s1 |
| InChIKey | ZPBIJIIQXPRJSS-WNZSCWOMSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| act-001 (CHEBI:754922) has role antineoplastic agent (CHEBI:35610) |
| act-001 (CHEBI:754922) is a γ-lactone (CHEBI:37581) |
| Synonyms | Source |
|---|---|
| Act-001 | ChEMBL |
| ACT001 | ChEMBL |
| Citations |
|---|