EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C18H17Cl2FN4OS |
| Net Charge | 0 |
| Average Mass | 463.793 |
| Monoisotopic Mass | 462.02509 |
| SMILES | Cl.[H][C@@](CN)(Cc1cccc(F)c1)NC(=O)c1cc(-c2c(Cl)cnn2C)c(Cl)s1 |
| InChI | InChI=1S/C18H17Cl2FN4OS.ClH/c1-25-16(14(19)9-23-25)13-7-15(27-17(13)20)18(26)24-12(8-22)6-10-3-2-4-11(21)5-10;/h2-5,7,9,12H,6,8,22H2,1H3,(H,24,26);1H/t12-;/m0./s1 |
| InChIKey | YFQJOPFTGMHYNV-YDALLXLXSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| afuresertib hydrochloride (CHEBI:754907) is a amphetamines (CHEBI:35338) |
| Synonyms | Source |
|---|---|
| Afuresertib hydrochloride | ChEMBL |
| GSK-2110183B | ChEMBL |
| GSK2110183B | ChEMBL |