EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C27H31FN4O8.HCl |
| Net Charge | 0 |
| Average Mass | 631.485 |
| Monoisotopic Mass | 630.16595 |
| SMILES | Cl.Cl.[H][C@@]12Cc3c(F)cc(NC(=O)CN4CCCC4)c(O)c3C(=O)C1=C(O)[C@]1(O)C(=O)C(C(N)=O)=C(O)[C@@]([H])(N(C)C)[C@]1([H])C2 |
| InChI | InChI=1S/C27H31FN4O8.2ClH/c1-31(2)20-13-8-11-7-12-14(28)9-15(30-16(33)10-32-5-3-4-6-32)21(34)18(12)22(35)17(11)24(37)27(13,40)25(38)19(23(20)36)26(29)39;;/h9,11,13,20,34,36-37,40H,3-8,10H2,1-2H3,(H2,29,39)(H,30,33);2*1H/t11-,13-,20-,27-;;/m0../s1 |
| InChIKey | JYCNMRVZELJVAW-RZVFYPHASA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eravacycline dihydrochloride (CHEBI:754900) is a tetracyclines (CHEBI:26895) |
| Synonyms | Source |
|---|---|
| Eravacycline dihydrochloride | ChEMBL |
| TP-434-046 | ChEMBL |
| TP434046 | ChEMBL |
| Brand Name | Source |
|---|---|
| Xerava | ChEMBL |