EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:754897 - recilisib sodium
| Formula | C16H12ClO4S.Na |
| Net Charge | 0 |
| Average Mass | 358.778 |
| Monoisotopic Mass | 358.00425 |
| SMILES | O=C([O-])c1ccc(/C=C/S(=O)(=O)Cc2ccc(Cl)cc2)cc1.[Na+] |
| InChI | InChI=1S/C16H13ClO4S.Na/c17-15-7-3-13(4-8-15)11-22(20,21)10-9-12-1-5-14(6-2-12)16(18)19;/h1-10H,11H2,(H,18,19);/q;+1/p-1/b10-9+; |
| InChIKey | PRFBWBYKWZVQJF-RRABGKBLSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| recilisib sodium (CHEBI:754897) is a benzoic acids (CHEBI:22723) |
| Synonyms | Source |
|---|---|
| ON-01210.NA | ChEMBL |
| ON 01210. Na | ChEMBL |
| ON-01210 SODIUM | ChEMBL |
| Recilisib sodium | ChEMBL |
| Brand Name | Source |
|---|---|
| Ex-rad | ChEMBL |
| Citations |
|---|