EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O7.C19H23N5O3 |
| Net Charge | 0 |
| Average Mass | 563.564 |
| Monoisotopic Mass | 563.22274 |
| SMILES | COc1cc(NCc2ccc3nc(N)nc(N)c3c2C)cc(OC)c1OC.O=C(O)[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H23N5O3.C6H10O7/c1-10-11(5-6-13-16(10)18(20)24-19(21)23-13)9-22-12-7-14(25-2)17(27-4)15(8-12)26-3;7-1-2(8)4(5(10)11)13-6(12)3(1)9/h5-8,22H,9H2,1-4H3,(H4,20,21,23,24);1-4,6-9,12H,(H,10,11)/t;1-,2-,3+,4-,6-/m.0/s1 |
| InChIKey | DQOGWKZQQBYYMW-LQGIGNHCSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trimetrexate glucuronate (CHEBI:754867) has role antifungal agent (CHEBI:35718) |
| trimetrexate glucuronate (CHEBI:754867) has role antineoplastic agent (CHEBI:35610) |
| trimetrexate glucuronate (CHEBI:754867) is a carbohydrate acid derivative (CHEBI:63436) |
| Synonyms | Source |
|---|---|
| NSC-352122 | ChEMBL |
| Trimetrexate d-glucuronate | ChEMBL |
| Brand Name | Source |
|---|---|
| Neutrexin | ChEMBL |