EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23Cl2N7 |
| Net Charge | 0 |
| Average Mass | 456.381 |
| Monoisotopic Mass | 455.13920 |
| SMILES | Cc1nn(C)cc1-c1nc2ncc(Cl)c(N3CCN(Cc4ccc(Cl)cc4)CC3)c2n1 |
| InChI | InChI=1S/C22H23Cl2N7/c1-14-17(13-29(2)28-14)21-26-19-20(18(24)11-25-22(19)27-21)31-9-7-30(8-10-31)12-15-3-5-16(23)6-4-15/h3-6,11,13H,7-10,12H2,1-2H3,(H,25,26,27) |
| InChIKey | AKJBLKUZXRMECW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mobinitinib (CHEBI:754849) has role antineoplastic agent (CHEBI:35610) |
| mobinitinib (CHEBI:754849) is a piperazines (CHEBI:26144) |
| mobinitinib (CHEBI:754849) is a pyridines (CHEBI:26421) |
| INN | Source |
|---|---|
| mobinitinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| CCT-241736 | ChEMBL |
| CCT241736 | ChEMBL |
| Ep-0042 | ChEMBL |
| Ep0042 | ChEMBL |
| Citations |
|---|