EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25F3N4O3S |
| Net Charge | 0 |
| Average Mass | 482.528 |
| Monoisotopic Mass | 482.15995 |
| SMILES | O=C(CNC(=O)c1cccc(C(F)(F)F)c1)NC1CN([C@H]2CC[C@@](O)(c3cncs3)CC2)C1 |
| InChI | InChI=1S/C22H25F3N4O3S/c23-22(24,25)15-3-1-2-14(8-15)20(31)27-10-19(30)28-16-11-29(12-16)17-4-6-21(32,7-5-17)18-9-26-13-33-18/h1-3,8-9,13,16-17,32H,4-7,10-12H2,(H,27,31)(H,28,30)/t17-,21- |
| InChIKey | CFKBNYUHQSQBSX-CYWCHRQTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jnj-41443532 (CHEBI:754845) has role hypoglycemic agent (CHEBI:35526) |
| jnj-41443532 (CHEBI:754845) is a N-acylglycine (CHEBI:16180) |
| Synonym | Source |
|---|---|
| Jnj-41443532 | ChEMBL |
| Citations |
|---|