EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H34N4O4 |
| Net Charge | 0 |
| Average Mass | 562.670 |
| Monoisotopic Mass | 562.25801 |
| SMILES | Cn1c(-c2ccccn2)c(C2CCCC2)c2ccc(C(=O)NC3(C(=O)Nc4ccc(/C=C/C(=O)O)cc4)CCC3)cc21 |
| InChI | InChI=1S/C34H34N4O4/c1-38-28-21-24(13-16-26(28)30(23-7-2-3-8-23)31(38)27-9-4-5-20-35-27)32(41)37-34(18-6-19-34)33(42)36-25-14-10-22(11-15-25)12-17-29(39)40/h4-5,9-17,20-21,23H,2-3,6-8,18-19H2,1H3,(H,36,42)(H,37,41)(H,39,40)/b17-12+ |
| InChIKey | JBSNALXXNTWUEC-SFQUDFHCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bilb-1941 (CHEBI:754843) has role antiviral agent (CHEBI:22587) |
| bilb-1941 (CHEBI:754843) is a N-acyl-amino acid (CHEBI:51569) |
| Synonyms | Source |
|---|---|
| Bilb 1941 | ChEMBL |
| Bilb-1941 | ChEMBL |
| BILB-1941ZW | ChEMBL |
| Citations |
|---|