EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H19P |
| Net Charge | +1 |
| Average Mass | 356.391 |
| Monoisotopic Mass | 356.12283 |
| SMILES | [18F]c1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H19FP/c25-20-16-18-24(19-17-20)26(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-19H/q+1/i25-1 |
| InChIKey | QWPLCHDPESWJRN-FNNGWQQSSA-N |
| Roles Classification |
|---|
| Chemical Role: | catalyst A substance that increases the rate of a reaction without modifying the overall standard Gibbs energy change in the reaction. |
| Application: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bfpet f-18 (CHEBI:754841) has role anti-arrhythmia drug (CHEBI:38070) |
| bfpet f-18 (CHEBI:754841) is a phosphine (CHEBI:35883) |
| Synonyms | Source |
|---|---|
| 18f-tpp | ChEMBL |
| 4-[18f]fluorophenyl)triphenylphosphonium | ChEMBL |
| 4-(18f)-tetraphenylphosphonium | ChEMBL |
| Bfpet f-18 | ChEMBL |
| Citations |
|---|