EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23N7O3 |
| Net Charge | 0 |
| Average Mass | 445.483 |
| Monoisotopic Mass | 445.18624 |
| SMILES | Cc1cc(C(=O)Nc2cc(Oc3ccc4nc(NC(=O)C5CC5)cn4n3)ccc2C)n(C)n1 |
| InChI | InChI=1S/C23H23N7O3/c1-13-4-7-16(11-17(13)24-23(32)18-10-14(2)27-29(18)3)33-21-9-8-20-25-19(12-30(20)28-21)26-22(31)15-5-6-15/h4,7-12,15H,5-6H2,1-3H3,(H,24,32)(H,26,31) |
| InChIKey | DZFZXPPHBWCXPQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tak-593 (CHEBI:754839) has role antineoplastic agent (CHEBI:35610) |
| tak-593 (CHEBI:754839) is a aromatic amide (CHEBI:62733) |
| Synonyms | Source |
|---|---|
| Tak-593 | ChEMBL |
| TAK 593 | ChEMBL |
| Citations |
|---|