EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29FN4O2 |
| Net Charge | 0 |
| Average Mass | 424.520 |
| Monoisotopic Mass | 424.22745 |
| SMILES | CCN(CC)CCNC(=O)c1c(C)nc2c1CCC/C2=C1/C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C24H29FN4O2/c1-4-29(5-2)12-11-26-23(30)20-14(3)27-22-16(20)7-6-8-17(22)21-18-13-15(25)9-10-19(18)28-24(21)31/h9-10,13,27H,4-8,11-12H2,1-3H3,(H,26,30)(H,28,31)/b21-17- |
| InChIKey | KGSRYTUWXUESJK-FXBPSFAMSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tafetinib (CHEBI:754838) has role antineoplastic agent (CHEBI:35610) |
| tafetinib (CHEBI:754838) is a indoles (CHEBI:24828) |
| Synonyms | Source |
|---|---|
| SIM 010603 | ChEMBL |
| SIM-010603 | ChEMBL |
| Tafetinib | ChEMBL |
| Citations |
|---|