EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32FN3O4 |
| Net Charge | 0 |
| Average Mass | 433.524 |
| Monoisotopic Mass | 433.23768 |
| SMILES | CC1(C)C(=O)N(C(=O)NCC2CCN(CC3(O)CCOCC3)CC2)c2cc(F)ccc21 |
| InChI | InChI=1S/C23H32FN3O4/c1-22(2)18-4-3-17(24)13-19(18)27(20(22)28)21(29)25-14-16-5-9-26(10-6-16)15-23(30)7-11-31-12-8-23/h3-4,13,16,30H,5-12,14-15H2,1-2H3,(H,25,29) |
| InChIKey | AGMOFKKOVMRGAK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pf-03382792 (CHEBI:754836) is a indolyl carboxylic acid (CHEBI:46867) |
| Synonym | Source |
|---|---|
| Pf-03382792 | ChEMBL |
| Citations |
|---|