EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H13ClF3N5O3S |
| Net Charge | 0 |
| Average Mass | 495.870 |
| Monoisotopic Mass | 495.03797 |
| SMILES | Cc1cnc(C(=O)c2ncnc3nccc23)c(NS(=O)(=O)c2ccc(Cl)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C20H13ClF3N5O3S/c1-10-6-15(29-33(31,32)11-2-3-14(21)13(7-11)20(22,23)24)17(26-8-10)18(30)16-12-4-5-25-19(12)28-9-27-16/h2-9,29H,1H3,(H,25,27,28) |
| InChIKey | LUUMLYXKTPBTQR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ilacirnon (CHEBI:754829) has role hypoglycemic agent (CHEBI:35526) |
| ilacirnon (CHEBI:754829) has role renoprotective agent (CHEBI:231911) |
| ilacirnon (CHEBI:754829) is a sulfonamide (CHEBI:35358) |
| INN | Source |
|---|---|
| ilacirnon | WHO MedNet |
| Synonyms | Source |
|---|---|
| CCX-140 | ChEMBL |
| CCX140 | ChEMBL |
| CCX140-B | ChEMBL |
| Citations |
|---|