EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19F3N4O3 |
| Net Charge | 0 |
| Average Mass | 396.369 |
| Monoisotopic Mass | 396.14093 |
| SMILES | O=C(O)c1ccc(NC(=O)[C@H](CC2CCCC2)n2cnc(C(F)(F)F)c2)nc1 |
| InChI | InChI=1S/C18H19F3N4O3/c19-18(20,21)14-9-25(10-23-14)13(7-11-3-1-2-4-11)16(26)24-15-6-5-12(8-22-15)17(27)28/h5-6,8-11,13H,1-4,7H2,(H,27,28)(H,22,24,26)/t13-/m0/s1 |
| InChIKey | GKMLFBRLRVQVJO-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | hypoglycemic agent A drug which lowers the blood glucose level. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pf-04991532 (CHEBI:754823) has role hypoglycemic agent (CHEBI:35526) |
| pf-04991532 (CHEBI:754823) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Synonym | Source |
|---|---|
| Pf-04991532 | ChEMBL |
| Citations |
|---|