EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:754821 - sabizabulin
| Formula | C21H19N3O4 |
| Net Charge | 0 |
| Average Mass | 377.400 |
| Monoisotopic Mass | 377.13756 |
| SMILES | COc1cc(C(=O)c2cnc(-c3cnc4ccccc34)n2)cc(OC)c1OC |
| InChI | InChI=1S/C21H19N3O4/c1-26-17-8-12(9-18(27-2)20(17)28-3)19(25)16-11-23-21(24-16)14-10-22-15-7-5-4-6-13(14)15/h4-11,22H,1-3H3,(H,23,24) |
| InChIKey | WQGVHOVEXMOLOK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sabizabulin (CHEBI:754821) has role antineoplastic agent (CHEBI:35610) |
| sabizabulin (CHEBI:754821) has role antiviral agent (CHEBI:22587) |
| sabizabulin (CHEBI:754821) is a aromatic ketone (CHEBI:76224) |
| INN | Source |
|---|---|
| sabizabulin | WHO MedNet |
| Synonyms | Source |
|---|---|
| ABI-231 | ChEMBL |
| APP-111 | ChEMBL |
| VERU-111 | ChEMBL |
| Citations |
|---|