EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23FN5O6P |
| Net Charge | 0 |
| Average Mass | 431.361 |
| Monoisotopic Mass | 431.13700 |
| SMILES | [H][C@@]12OP(=O)(OC(C)C)OC[C@@]1([H])O[C@@H](n1cnc3c(OCC)nc(N)nc31)[C@]2(C)F |
| InChI | InChI=1S/C16H23FN5O6P/c1-5-24-13-10-12(20-15(18)21-13)22(7-19-10)14-16(4,17)11-9(26-14)6-25-29(23,28-11)27-8(2)3/h7-9,11,14H,5-6H2,1-4H3,(H2,18,20,21)/t9-,11-,14-,16-,29?/m1/s1 |
| InChIKey | PVRFQJIRERYGTQ-UYISCHNFSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| psi-352938 (CHEBI:754820) has role antiviral agent (CHEBI:22587) |
| psi-352938 (CHEBI:754820) is a purines (CHEBI:26401) |
| Synonyms | Source |
|---|---|
| GS-0938 | ChEMBL |
| GS0938 | ChEMBL |
| PSI-352938 | ChEMBL |
| PSI352938 | ChEMBL |
| PSI-938 | ChEMBL |
| PSI938 | ChEMBL |
| Citations |
|---|