EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H33N3O3S |
| Net Charge | 0 |
| Average Mass | 419.591 |
| Monoisotopic Mass | 419.22426 |
| SMILES | CCCSc1nc(N2CCC[C@@H](CC(=O)O)C2)ccc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H33N3O3S/c1-2-13-29-22-18(21(28)23-17-8-4-3-5-9-17)10-11-19(24-22)25-12-6-7-16(15-25)14-20(26)27/h10-11,16-17H,2-9,12-15H2,1H3,(H,23,28)(H,26,27)/t16-/m0/s1 |
| InChIKey | NCDZABJPWMBMIQ-INIZCTEOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anti-obesity agent Any substance which is used to reduce or control weight. |
| Applications: | hypoglycemic agent A drug which lowers the blood glucose level. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd-4017 (CHEBI:754817) has role anti-obesity agent (CHEBI:74518) |
| azd-4017 (CHEBI:754817) has role antihypertensive agent (CHEBI:35674) |
| azd-4017 (CHEBI:754817) has role hypoglycemic agent (CHEBI:35526) |
| azd-4017 (CHEBI:754817) is a aromatic carboxylic acid (CHEBI:33859) |
| azd-4017 (CHEBI:754817) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| Synonyms | Source |
|---|---|
| Azd 4017 | ChEMBL |
| Azd-4017 | ChEMBL |
| AZD4017 | ChEMBL |
| Citations |
|---|