EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H32N2O6 |
| Net Charge | 0 |
| Average Mass | 432.517 |
| Monoisotopic Mass | 432.22604 |
| SMILES | OC1(CN2CCC(COc3noc4cccc(O[C@@H]5CCOC5)c34)CC2)CCOCC1 |
| InChI | InChI=1S/C23H32N2O6/c26-23(7-12-27-13-8-23)16-25-9-4-17(5-10-25)14-29-22-21-19(30-18-6-11-28-15-18)2-1-3-20(21)31-24-22/h1-3,17-18,26H,4-16H2/t18-/m1/s1 |
| InChIKey | WLLOFQROROXOMO-GOSISDBHSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pf-04995274 (CHEBI:754816) has role antidepressant (CHEBI:35469) |
| pf-04995274 (CHEBI:754816) is a benzisoxazole (CHEBI:51549) |
| Synonym | Source |
|---|---|
| Pf-04995274 | ChEMBL |
| Citations |
|---|