EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H17ClN2OS |
| Net Charge | 0 |
| Average Mass | 320.845 |
| Monoisotopic Mass | 320.07501 |
| SMILES | O=C(N[C@H]1CN2CCC1CC2)c1cc2cccc(Cl)c2s1 |
| InChI | InChI=1S/C16H17ClN2OS/c17-12-3-1-2-11-8-14(21-15(11)12)16(20)18-13-9-19-6-4-10(13)5-7-19/h1-3,8,10,13H,4-7,9H2,(H,18,20)/t13-/m0/s1 |
| InChIKey | SSRDSYXGYPJKRR-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| encenicline (CHEBI:754814) has role antipsychotic agent (CHEBI:35476) |
| encenicline (CHEBI:754814) has role renoprotective agent (CHEBI:231911) |
| encenicline (CHEBI:754814) is a 1-benzothiophenes (CHEBI:38836) |
| INNs | Source |
|---|---|
| enceniclina | WHO MedNet |
| encenicline | WHO MedNet |
| Synonyms | Source |
|---|---|
| EVP-6124 | ChEMBL |
| MT-4666 | ChEMBL |
| MT4666 | ChEMBL |
| Citations |
|---|