EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:754811 - azd0328
| Formula | C13H16N2O |
| Net Charge | 0 |
| Average Mass | 216.284 |
| Monoisotopic Mass | 216.12626 |
| SMILES | c1cnc2c(c1)C[C@@]1(CN3CCC1CC3)O2 |
| InChI | InChI=1S/C13H16N2O/c1-2-10-8-13(16-12(10)14-5-1)9-15-6-3-11(13)4-7-15/h1-2,5,11H,3-4,6-9H2/t13-/m0/s1 |
| InChIKey | OCKIPDMKGPYYJS-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| azd0328 (CHEBI:754811) has role antipsychotic agent (CHEBI:35476) |
| azd0328 (CHEBI:754811) is a quinuclidines (CHEBI:26518) |
| Synonyms | Source |
|---|---|
| Azd 0328 | ChEMBL |
| Azd-0328 | ChEMBL |
| AZD0328 | ChEMBL |
| Citations |
|---|