EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24F2N2O |
| Net Charge | 0 |
| Average Mass | 322.399 |
| Monoisotopic Mass | 322.18567 |
| SMILES | CCNC(=O)[C@H]1C[C@@](F)(c2ccc(CN3CCCC3)c(F)c2)C1 |
| InChI | InChI=1S/C18H24F2N2O/c1-2-21-17(23)14-10-18(20,11-14)15-6-5-13(16(19)9-15)12-22-7-3-4-8-22/h5-6,9,14H,2-4,7-8,10-12H2,1H3,(H,21,23)/t14-,18- |
| InChIKey | SXMBKHYDZOCBMT-PPUGGXLSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pf-03654746 (CHEBI:754809) has role antipsychotic agent (CHEBI:35476) |
| pf-03654746 (CHEBI:754809) is a aromatic amine (CHEBI:33860) |
| Synonyms | Source |
|---|---|
| Pf-03654746 | ChEMBL |
| PF 03654746 | ChEMBL |
| Citations |
|---|