EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:754799 - leteprinim potassium
| Formula | K.C15H12N5O4 |
| Net Charge | 0 |
| Average Mass | 365.390 |
| Monoisotopic Mass | 365.05264 |
| SMILES | O=C(CCn1cnc2c(=O)ncnc21)Nc1ccc(C(=O)[O-])cc1.[K+] |
| InChI | InChI=1S/C15H13N5O4.K/c21-11(19-10-3-1-9(2-4-10)15(23)24)5-6-20-8-18-12-13(20)16-7-17-14(12)22;/h1-4,7-8H,5-6H2,(H,19,21)(H,23,24)(H,16,17,22);/q;+1/p-1 |
| InChIKey | MICLTPPSCUXHJT-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leteprinim potassium (CHEBI:754799) is a amidobenzoic acid (CHEBI:48470) |
| Synonyms | Source |
|---|---|
| AIT-082 | ChEMBL |
| Leteprinim potassium salt | ChEMBL |
| Brand Name | Source |
|---|---|
| Neotrofin | ChEMBL |